C13H16BrNO3 — CID 15432216
methyl (2S)-2-[[(2R)-2-bromo-2-(4-methylphenyl)acetyl]amino]propanoate (PubChem CID 15432216) has the molecular formula C13H16BrNO3 and a molecular weight of 314.18 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R)-2-bromo-2-(4-methylphenyl)acetyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[(2R)-2-bromo-2-(4-methylphenyl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 15432216 |
| Molecular Formula | C13H16BrNO3 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | methyl (2S)-2-[[(2R)-2-bromo-2-(4-methylphenyl)acetyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)[C@H](Br)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H16BrNO3/c1-8-4-6-10(7-5-8)11(14)12(16)15-9(2)13(17)18-3/h4-7,9,11H,1-3H3,(H,15,16)/t9-,11+/m0/s1 |
| InChIKey | JOOLRFDPUQZDPT-GXSJLCMTSA-N |
| XLogP | 2.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|