C19H22N2O — CID 15432629
N-butyl-4-methyl-3-naphthalen-1-yl-2,3-dihydroazete-2-carboxamide (PubChem CID 15432629) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is N-butyl-4-methyl-3-naphthalen-1-yl-2,3-dihydroazete-2-carboxamide.
| Compound Name | N-butyl-4-methyl-3-naphthalen-1-yl-2,3-dihydroazete-2-carboxamide |
|---|---|
| PubChem CID | 15432629 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-butyl-4-methyl-3-naphthalen-1-yl-2,3-dihydroazete-2-carboxamide |
| SMILES | CCCCNC(=O)C1N=C(C)C1c1cccc2ccccc12 |
| InChI | InChI=1S/C19H22N2O/c1-3-4-12-20-19(22)18-17(13(2)21-18)16-11-7-9-14-8-5-6-10-15(14)16/h5-11,17-18H,3-4,12H2,1-2H3,(H,20,22) |
| InChIKey | OETRDJKLCNYFFS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|