C8H7N3 — CID 154328664
cyclopenta[e][1,3]diazepin-3-amine (PubChem CID 154328664) has the molecular formula C8H7N3 and a molecular weight of 145.16 g/mol. Its IUPAC name is cyclopenta[e][1,3]diazepin-3-amine.
| Compound Name | cyclopenta[e][1,3]diazepin-3-amine |
|---|---|
| PubChem CID | 154328664 |
| Molecular Formula | C8H7N3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | cyclopenta[e][1,3]diazepin-3-amine |
| SMILES | Nc1ncc2cccc-2cn1 |
| InChI | InChI=1S/C8H7N3/c9-8-10-4-6-2-1-3-7(6)5-11-8/h1-5H,(H2,9,10,11) |
| InChIKey | PHAKQDXACWHTLE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |