C22H16N6 — CID 15505619
5-[10-(2-aminopyrimidin-5-yl)anthracen-9-yl]pyrimidin-2-amine (PubChem CID 15505619) has the molecular formula C22H16N6 and a molecular weight of 364.41 g/mol. Its IUPAC name is 5-[10-(2-aminopyrimidin-5-yl)anthracen-9-yl]pyrimidin-2-amine.
| Compound Name | 5-[10-(2-aminopyrimidin-5-yl)anthracen-9-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 15505619 |
| Molecular Formula | C22H16N6 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 5-[10-(2-aminopyrimidin-5-yl)anthracen-9-yl]pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2c3ccccc3c(-c3cnc(N)nc3)c3ccccc23)cn1 |
| InChI | InChI=1S/C22H16N6/c23-21-25-9-13(10-26-21)19-15-5-1-2-6-16(15)20(14-11-27-22(24)28-12-14)18-8-4-3-7-17(18)19/h1-12H,(H2,23,25,26)(H2,24,27,28) |
| InChIKey | AVPOIKRDIRPSPS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|