About (N-hydroxy-C-methylcarbonimidoyl) 2-ethoxybenzoate
(N-hydroxy-C-methylcarbonimidoyl) 2-ethoxybenzoate (PubChem CID 154337054) has the molecular formula C11H13NO4
and a molecular weight of 223.23 g/mol. Its IUPAC name is (N-hydroxy-C-methylcarbonimidoyl) 2-ethoxybenzoate.
Molecular Properties
| Compound Name | (N-hydroxy-C-methylcarbonimidoyl) 2-ethoxybenzoate |
| PubChem CID | 154337054 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | (N-hydroxy-C-methylcarbonimidoyl) 2-ethoxybenzoate |
| SMILES | CCOc1ccccc1C(=O)OC(C)=NO |
| InChI | InChI=1S/C11H13NO4/c1-3-15-10-7-5-4-6-9(10)11(13)16-8(2)12-14/h4-7,14H,3H2,1-2H3 |
| InChIKey | KSTXBPCNCMREKA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (N-hydroxy-C-methylcarbonimidoyl) 2-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (N-hydroxy-C-methylcarbonimidoyl) 2-ethoxybenzoate?
The IUPAC name of (N-hydroxy-C-methylcarbonimidoyl) 2-ethoxybenzoate (CID 154337054) is (N-hydroxy-C-methylcarbonimidoyl) 2-ethoxybenzoate.
What is the SMILES notation for (N-hydroxy-C-methylcarbonimidoyl) 2-ethoxybenzoate?
The canonical SMILES for (N-hydroxy-C-methylcarbonimidoyl) 2-ethoxybenzoate is CCOc1ccccc1C(=O)OC(C)=NO.
What is the InChIKey of (N-hydroxy-C-methylcarbonimidoyl) 2-ethoxybenzoate?
The InChIKey is KSTXBPCNCMREKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO4/c1-3-15-10-7-5-4-6-9(10)11(13)16-8(2)12-14/h4-7,14H,3H2,1-2H3.
What are the key properties of (N-hydroxy-C-methylcarbonimidoyl) 2-ethoxybenzoate?
(N-hydroxy-C-methylcarbonimidoyl) 2-ethoxybenzoate has a molecular weight of 223.23 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (N-hydroxy-C-methylcarbonimidoyl) 2-ethoxybenzoate is sourced from PubChem (CID 154337054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).