C19H22N4O2S — CID 154339753
4-(4-cyanophenyl)-N-(4,6-dimethyl-2-pyridinyl)piperidine-1-sulfonamide (PubChem CID 154339753) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is 4-(4-cyanophenyl)-N-(4,6-dimethyl-2-pyridinyl)piperidine-1-sulfonamide.
| Compound Name | 4-(4-cyanophenyl)-N-(4,6-dimethyl-2-pyridinyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 154339753 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 4-(4-cyanophenyl)-N-(4,6-dimethyl-2-pyridinyl)piperidine-1-sulfonamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)N2CCC(c3ccc(C#N)cc3)CC2)c1 |
| InChI | InChI=1S/C19H22N4O2S/c1-14-11-15(2)21-19(12-14)22-26(24,25)23-9-7-18(8-10-23)17-5-3-16(13-20)4-6-17/h3-6,11-12,18H,7-10H2,1-2H3,(H,21,22) |
| InChIKey | GPJYIEHZAIVMEW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |