C26H26Cl2N2O2 — CID 15434905
N-[2-(3,4-dichlorophenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)ethyl]benzamide (PubChem CID 15434905) has the molecular formula C26H26Cl2N2O2 and a molecular weight of 469.41 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)ethyl]benzamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 15434905 |
| Molecular Formula | C26H26Cl2N2O2 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)ethyl]benzamide |
| SMILES | O=C(NCC(c1ccc(Cl)c(Cl)c1)N1CCC(O)(c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C26H26Cl2N2O2/c27-22-12-11-20(17-23(22)28)24(18-29-25(31)19-7-3-1-4-8-19)30-15-13-26(32,14-16-30)21-9-5-2-6-10-21/h1-12,17,24,32H,13-16,18H2,(H,29,31) |
| InChIKey | NJFNGPHHPDOZHS-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |