C21H22ClN3O2S2 — CID 154353114
3-[(4-chlorophenyl)methyl]-7-methyl-2-(morpholin-4-ylmethyl)-4-sulfanylidenethieno[2,3-b]pyridine-5-carboxamide (PubChem CID 154353114) has the molecular formula C21H22ClN3O2S2 and a molecular weight of 448.01 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-7-methyl-2-(morpholin-4-ylmethyl)-4-sulfanylidenethieno[2,3-b]pyridine-5-carboxamide.
| Compound Name | 3-[(4-chlorophenyl)methyl]-7-methyl-2-(morpholin-4-ylmethyl)-4-sulfanylidenethieno[2,3-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 154353114 |
| Molecular Formula | C21H22ClN3O2S2 |
| Molecular Weight | 448.01 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-7-methyl-2-(morpholin-4-ylmethyl)-4-sulfanylidenethieno[2,3-b]pyridine-5-carboxamide |
| SMILES | Cn1cc(C(N)=O)c(=S)c2c(Cc3ccc(Cl)cc3)c(CN3CCOCC3)sc21 |
| InChI | InChI=1S/C21H22ClN3O2S2/c1-24-11-16(20(23)26)19(28)18-15(10-13-2-4-14(22)5-3-13)17(29-21(18)24)12-25-6-8-27-9-7-25/h2-5,11H,6-10,12H2,1H3,(H2,23,26) |
| InChIKey | CXHSWAOYROIBDU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.01 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|