About 3-chloro-N,N-bis(4-chlorophenyl)-5-(morpholin-4-ylmethyl)thiophene-2-carboxamide
3-chloro-N,N-bis(4-chlorophenyl)-5-(morpholin-4-ylmethyl)thiophene-2-carboxamide (PubChem CID 141010360) has the molecular formula C22H19Cl3N2O2S
and a molecular weight of 481.83 g/mol. Its IUPAC name is 3-chloro-N,N-bis(4-chlorophenyl)-5-(morpholin-4-ylmethyl)thiophene-2-carboxamide.
Molecular Properties
| Compound Name | 3-chloro-N,N-bis(4-chlorophenyl)-5-(morpholin-4-ylmethyl)thiophene-2-carboxamide |
| PubChem CID | 141010360 |
| Molecular Formula | C22H19Cl3N2O2S |
| Molecular Weight | 481.83 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | 3-chloro-N,N-bis(4-chlorophenyl)-5-(morpholin-4-ylmethyl)thiophene-2-carboxamide |
| SMILES | O=C(c1sc(CN2CCOCC2)cc1Cl)N(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H19Cl3N2O2S/c23-15-1-5-17(6-2-15)27(18-7-3-16(24)4-8-18)22(28)21-20(25)13-19(30-21)14-26-9-11-29-12-10-26/h1-8,13H,9-12,14H2 |
| InChIKey | ANEAPCPYYCBRSE-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.83 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-N,N-bis(4-chlorophenyl)-5-(morpholin-4-ylmethyl)thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N,N-bis(4-chlorophenyl)-5-(morpholin-4-ylmethyl)thiophene-2-carboxamide?
The IUPAC name of 3-chloro-N,N-bis(4-chlorophenyl)-5-(morpholin-4-ylmethyl)thiophene-2-carboxamide (CID 141010360) is 3-chloro-N,N-bis(4-chlorophenyl)-5-(morpholin-4-ylmethyl)thiophene-2-carboxamide.
What is the SMILES notation for 3-chloro-N,N-bis(4-chlorophenyl)-5-(morpholin-4-ylmethyl)thiophene-2-carboxamide?
The canonical SMILES for 3-chloro-N,N-bis(4-chlorophenyl)-5-(morpholin-4-ylmethyl)thiophene-2-carboxamide is O=C(c1sc(CN2CCOCC2)cc1Cl)N(c1ccc(Cl)cc1)c1ccc(Cl)cc1.
What is the InChIKey of 3-chloro-N,N-bis(4-chlorophenyl)-5-(morpholin-4-ylmethyl)thiophene-2-carboxamide?
The InChIKey is ANEAPCPYYCBRSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19Cl3N2O2S/c23-15-1-5-17(6-2-15)27(18-7-3-16(24)4-8-18)22(28)21-20(25)13-19(30-21)14-26-9-11-29-12-10-26/h1-8,13H,9-12,14H2.
What are the key properties of 3-chloro-N,N-bis(4-chlorophenyl)-5-(morpholin-4-ylmethyl)thiophene-2-carboxamide?
3-chloro-N,N-bis(4-chlorophenyl)-5-(morpholin-4-ylmethyl)thiophene-2-carboxamide has a molecular weight of 481.83 g/mol, XLogP of 6.52, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N,N-bis(4-chlorophenyl)-5-(morpholin-4-ylmethyl)thiophene-2-carboxamide is sourced from PubChem (CID 141010360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).