C10H13ClN2OS2 — CID 141010438
3-chloro-5-(thiomorpholin-4-ylmethyl)thiophene-2-carboxamide (PubChem CID 141010438) has the molecular formula C10H13ClN2OS2 and a molecular weight of 276.81 g/mol. Its IUPAC name is 3-chloro-5-(thiomorpholin-4-ylmethyl)thiophene-2-carboxamide.
| Compound Name | 3-chloro-5-(thiomorpholin-4-ylmethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 141010438 |
| Molecular Formula | C10H13ClN2OS2 |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 3-chloro-5-(thiomorpholin-4-ylmethyl)thiophene-2-carboxamide |
| SMILES | NC(=O)c1sc(CN2CCSCC2)cc1Cl |
| InChI | InChI=1S/C10H13ClN2OS2/c11-8-5-7(16-9(8)10(12)14)6-13-1-3-15-4-2-13/h5H,1-4,6H2,(H2,12,14) |
| InChIKey | BSMQRZYEYJOZTF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |