C14H20ClN3O2 — CID 21398140
1-(4-chlorophenyl)-3,3-dimethyl-1-(morpholin-4-ylmethyl)urea (PubChem CID 21398140) has the molecular formula C14H20ClN3O2 and a molecular weight of 297.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3,3-dimethyl-1-(morpholin-4-ylmethyl)urea.
| Compound Name | 1-(4-chlorophenyl)-3,3-dimethyl-1-(morpholin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 21398140 |
| Molecular Formula | C14H20ClN3O2 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 1-(4-chlorophenyl)-3,3-dimethyl-1-(morpholin-4-ylmethyl)urea |
| SMILES | CN(C)C(=O)N(CN1CCOCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H20ClN3O2/c1-16(2)14(19)18(11-17-7-9-20-10-8-17)13-5-3-12(15)4-6-13/h3-6H,7-11H2,1-2H3 |
| InChIKey | BVWYRPSSOOWQFP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |