C10H11F3N2O3S2 — CID 154353701
(2S)-2-amino-3-sulfanyl-2-[4-(trifluoromethyl)phenyl]sulfonylpropanamide (PubChem CID 154353701) has the molecular formula C10H11F3N2O3S2 and a molecular weight of 328.34 g/mol. Its IUPAC name is (2S)-2-amino-3-sulfanyl-2-[4-(trifluoromethyl)phenyl]sulfonylpropanamide.
| Compound Name | (2S)-2-amino-3-sulfanyl-2-[4-(trifluoromethyl)phenyl]sulfonylpropanamide |
|---|---|
| PubChem CID | 154353701 |
| Molecular Formula | C10H11F3N2O3S2 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | (2S)-2-amino-3-sulfanyl-2-[4-(trifluoromethyl)phenyl]sulfonylpropanamide |
| SMILES | NC(=O)[C@@](N)(CS)S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11F3N2O3S2/c11-10(12,13)6-1-3-7(4-2-6)20(17,18)9(15,5-19)8(14)16/h1-4,19H,5,15H2,(H2,14,16)/t9-/m1/s1 |
| InChIKey | DPHGRJDAPHFHPT-SECBINFHSA-N |
| XLogP | 0.55 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|