C16H24N2O4 — CID 154371473
2-amino-2-[5-(aminomethyl)-2-hydroxybenzoyl]octanoic acid (PubChem CID 154371473) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-amino-2-[5-(aminomethyl)-2-hydroxybenzoyl]octanoic acid.
| Compound Name | 2-amino-2-[5-(aminomethyl)-2-hydroxybenzoyl]octanoic acid |
|---|---|
| PubChem CID | 154371473 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 2-amino-2-[5-(aminomethyl)-2-hydroxybenzoyl]octanoic acid |
| SMILES | CCCCCCC(N)(C(=O)O)C(=O)c1cc(CN)ccc1O |
| InChI | InChI=1S/C16H24N2O4/c1-2-3-4-5-8-16(18,15(21)22)14(20)12-9-11(10-17)6-7-13(12)19/h6-7,9,19H,2-5,8,10,17-18H2,1H3,(H,21,22) |
| InChIKey | HGIWHZAAJUBHNT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|