C14H15NO3S — CID 15437506
2-(benzenesulfonyl)-5-propa-1,2-dienoxypentanenitrile (PubChem CID 15437506) has the molecular formula C14H15NO3S and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-5-propa-1,2-dienoxypentanenitrile.
| Compound Name | 2-(benzenesulfonyl)-5-propa-1,2-dienoxypentanenitrile |
|---|---|
| PubChem CID | 15437506 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 2-(benzenesulfonyl)-5-propa-1,2-dienoxypentanenitrile |
| SMILES | C=C=COCCCC(C#N)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H15NO3S/c1-2-10-18-11-6-9-14(12-15)19(16,17)13-7-4-3-5-8-13/h3-5,7-8,10,14H,1,6,9,11H2 |
| InChIKey | SFXIIQMTUBZPBS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|