About 7-iminonona-1,8-dien-3-one
7-iminonona-1,8-dien-3-one (PubChem CID 154380491) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 7-iminonona-1,8-dien-3-one.
Molecular Properties
| Compound Name | 7-iminonona-1,8-dien-3-one |
| PubChem CID | 154380491 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 7-iminonona-1,8-dien-3-one |
| SMILES | [H]/N=C(\C=C)CCCC(=O)C=C |
| InChI | InChI=1S/C9H13NO/c1-3-8(10)6-5-7-9(11)4-2/h3-4,10H,1-2,5-7H2/b10-8+ |
| InChIKey | YTUAWSXORRWWDH-CSKARUKUSA-N |
| XLogP | 2.12 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 7-iminonona-1,8-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iminonona-1,8-dien-3-one?
The IUPAC name of 7-iminonona-1,8-dien-3-one (CID 154380491) is 7-iminonona-1,8-dien-3-one.
What is the SMILES notation for 7-iminonona-1,8-dien-3-one?
The canonical SMILES for 7-iminonona-1,8-dien-3-one is [H]/N=C(\C=C)CCCC(=O)C=C.
What is the InChIKey of 7-iminonona-1,8-dien-3-one?
The InChIKey is YTUAWSXORRWWDH-CSKARUKUSA-N. The full InChI is InChI=1S/C9H13NO/c1-3-8(10)6-5-7-9(11)4-2/h3-4,10H,1-2,5-7H2/b10-8+.
What are the key properties of 7-iminonona-1,8-dien-3-one?
7-iminonona-1,8-dien-3-one has a molecular weight of 151.21 g/mol, XLogP of 2.12, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iminonona-1,8-dien-3-one is sourced from PubChem (CID 154380491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).