About 4-iminooct-7-en-2-one
4-iminooct-7-en-2-one (PubChem CID 123949243) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 4-iminooct-7-en-2-one.
Molecular Properties
| Compound Name | 4-iminooct-7-en-2-one |
| PubChem CID | 123949243 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 4-iminooct-7-en-2-one |
| SMILES | [H]/N=C(\CCC=C)CC(C)=O |
| InChI | InChI=1S/C8H13NO/c1-3-4-5-8(9)6-7(2)10/h3,9H,1,4-6H2,2H3/b9-8+ |
| InChIKey | WKHYVTQYHZQFFU-CMDGGOBGSA-N |
| XLogP | 1.95 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-iminooct-7-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iminooct-7-en-2-one?
The IUPAC name of 4-iminooct-7-en-2-one (CID 123949243) is 4-iminooct-7-en-2-one.
What is the SMILES notation for 4-iminooct-7-en-2-one?
The canonical SMILES for 4-iminooct-7-en-2-one is [H]/N=C(\CCC=C)CC(C)=O.
What is the InChIKey of 4-iminooct-7-en-2-one?
The InChIKey is WKHYVTQYHZQFFU-CMDGGOBGSA-N. The full InChI is InChI=1S/C8H13NO/c1-3-4-5-8(9)6-7(2)10/h3,9H,1,4-6H2,2H3/b9-8+.
What are the key properties of 4-iminooct-7-en-2-one?
4-iminooct-7-en-2-one has a molecular weight of 139.20 g/mol, XLogP of 1.95, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iminooct-7-en-2-one is sourced from PubChem (CID 123949243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).