About 2-iminohept-6-en-3-one
2-iminohept-6-en-3-one (PubChem CID 123621862) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is 2-iminohept-6-en-3-one.
Molecular Properties
| Compound Name | 2-iminohept-6-en-3-one |
| PubChem CID | 123621862 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 2-iminohept-6-en-3-one |
| SMILES | [H]/N=C(\C)C(=O)CCC=C |
| InChI | InChI=1S/C7H11NO/c1-3-4-5-7(9)6(2)8/h3,8H,1,4-5H2,2H3/b8-6+ |
| InChIKey | XQJOOJCNSPKTDQ-SOFGYWHQSA-N |
| XLogP | 1.56 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-iminohept-6-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iminohept-6-en-3-one?
The IUPAC name of 2-iminohept-6-en-3-one (CID 123621862) is 2-iminohept-6-en-3-one.
What is the SMILES notation for 2-iminohept-6-en-3-one?
The canonical SMILES for 2-iminohept-6-en-3-one is [H]/N=C(\C)C(=O)CCC=C.
What is the InChIKey of 2-iminohept-6-en-3-one?
The InChIKey is XQJOOJCNSPKTDQ-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H11NO/c1-3-4-5-7(9)6(2)8/h3,8H,1,4-5H2,2H3/b8-6+.
What are the key properties of 2-iminohept-6-en-3-one?
2-iminohept-6-en-3-one has a molecular weight of 125.17 g/mol, XLogP of 1.56, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iminohept-6-en-3-one is sourced from PubChem (CID 123621862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).