About ethane;3-iminopent-4-en-2-one
ethane;3-iminopent-4-en-2-one (PubChem CID 145294770) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is ethane;3-iminopent-4-en-2-one.
Molecular Properties
| Compound Name | ethane;3-iminopent-4-en-2-one |
| PubChem CID | 145294770 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | ethane;3-iminopent-4-en-2-one |
| SMILES | CC.[H]/N=C(\C=C)C(C)=O |
| InChI | InChI=1S/C5H7NO.C2H6/c1-3-5(6)4(2)7;1-2/h3,6H,1H2,2H3;1-2H3/b6-5+; |
| InChIKey | ONFLHBXAGXKHBK-IPZCTEOASA-N |
| XLogP | 1.81 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-iminopent-4-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-iminopent-4-en-2-one?
The IUPAC name of ethane;3-iminopent-4-en-2-one (CID 145294770) is ethane;3-iminopent-4-en-2-one.
What is the SMILES notation for ethane;3-iminopent-4-en-2-one?
The canonical SMILES for ethane;3-iminopent-4-en-2-one is CC.[H]/N=C(\C=C)C(C)=O.
What is the InChIKey of ethane;3-iminopent-4-en-2-one?
The InChIKey is ONFLHBXAGXKHBK-IPZCTEOASA-N. The full InChI is InChI=1S/C5H7NO.C2H6/c1-3-5(6)4(2)7;1-2/h3,6H,1H2,2H3;1-2H3/b6-5+;.
What are the key properties of ethane;3-iminopent-4-en-2-one?
ethane;3-iminopent-4-en-2-one has a molecular weight of 127.19 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-iminopent-4-en-2-one is sourced from PubChem (CID 145294770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).