About ethene;3-iminopent-4-en-2-one
ethene;3-iminopent-4-en-2-one (PubChem CID 156729474) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is ethene;3-iminopent-4-en-2-one.
Molecular Properties
| Compound Name | ethene;3-iminopent-4-en-2-one |
| PubChem CID | 156729474 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | ethene;3-iminopent-4-en-2-one |
| SMILES | C=C.[H]/N=C(\C=C)C(C)=O |
| InChI | InChI=1S/C5H7NO.C2H4/c1-3-5(6)4(2)7;1-2/h3,6H,1H2,2H3;1-2H2/b6-5+; |
| InChIKey | HLMHAFJTMUWLQB-IPZCTEOASA-N |
| XLogP | 1.58 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;3-iminopent-4-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;3-iminopent-4-en-2-one?
The IUPAC name of ethene;3-iminopent-4-en-2-one (CID 156729474) is ethene;3-iminopent-4-en-2-one.
What is the SMILES notation for ethene;3-iminopent-4-en-2-one?
The canonical SMILES for ethene;3-iminopent-4-en-2-one is C=C.[H]/N=C(\C=C)C(C)=O.
What is the InChIKey of ethene;3-iminopent-4-en-2-one?
The InChIKey is HLMHAFJTMUWLQB-IPZCTEOASA-N. The full InChI is InChI=1S/C5H7NO.C2H4/c1-3-5(6)4(2)7;1-2/h3,6H,1H2,2H3;1-2H2/b6-5+;.
What are the key properties of ethene;3-iminopent-4-en-2-one?
ethene;3-iminopent-4-en-2-one has a molecular weight of 125.17 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;3-iminopent-4-en-2-one is sourced from PubChem (CID 156729474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).