About 4-iminohex-5-en-2-one
4-iminohex-5-en-2-one (PubChem CID 123981827) has the molecular formula C6H9NO
and a molecular weight of 111.14 g/mol. Its IUPAC name is 4-iminohex-5-en-2-one.
Molecular Properties
| Compound Name | 4-iminohex-5-en-2-one |
| PubChem CID | 123981827 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | 4-iminohex-5-en-2-one |
| SMILES | [H]/N=C(\C=C)CC(C)=O |
| InChI | InChI=1S/C6H9NO/c1-3-6(7)4-5(2)8/h3,7H,1,4H2,2H3/b7-6+ |
| InChIKey | HHMWULJOANHIIV-VOTSOKGWSA-N |
| XLogP | 1.17 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-iminohex-5-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iminohex-5-en-2-one?
The IUPAC name of 4-iminohex-5-en-2-one (CID 123981827) is 4-iminohex-5-en-2-one.
What is the SMILES notation for 4-iminohex-5-en-2-one?
The canonical SMILES for 4-iminohex-5-en-2-one is [H]/N=C(\C=C)CC(C)=O.
What is the InChIKey of 4-iminohex-5-en-2-one?
The InChIKey is HHMWULJOANHIIV-VOTSOKGWSA-N. The full InChI is InChI=1S/C6H9NO/c1-3-6(7)4-5(2)8/h3,7H,1,4H2,2H3/b7-6+.
What are the key properties of 4-iminohex-5-en-2-one?
4-iminohex-5-en-2-one has a molecular weight of 111.14 g/mol, XLogP of 1.17, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iminohex-5-en-2-one is sourced from PubChem (CID 123981827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).