C14H26O2 — CID 15438228
2,3,3,6,6,7-hexamethyloct-4-yne-2,7-diol (PubChem CID 15438228) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 2,3,3,6,6,7-hexamethyloct-4-yne-2,7-diol.
| Compound Name | 2,3,3,6,6,7-hexamethyloct-4-yne-2,7-diol |
|---|---|
| PubChem CID | 15438228 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 2,3,3,6,6,7-hexamethyloct-4-yne-2,7-diol |
| SMILES | CC(C)(O)C(C)(C)C#CC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C14H26O2/c1-11(2,13(5,6)15)9-10-12(3,4)14(7,8)16/h15-16H,1-8H3 |
| InChIKey | JTRFHAJFDIIZLM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|