C30H46O7 — CID 15439103
(3,3,9,11,11-pentamethyl-1,5-dioxaspiro[5.5]undec-9-ene-10-carbonyl) 3,3,9,11,11-pentamethyl-1,5-dioxaspiro[5.5]undec-9-ene-10-carboxylate (PubChem CID 15439103) has the molecular formula C30H46O7 and a molecular weight of 518.69 g/mol. Its IUPAC name is (3,3,9,11,11-pentamethyl-1,5-dioxaspiro[5.5]undec-9-ene-10-carbonyl) 3,3,9,11,11-pentamethyl-1,5-dioxaspiro[5.5]undec-9-ene-10-carboxylate.
| Compound Name | (3,3,9,11,11-pentamethyl-1,5-dioxaspiro[5.5]undec-9-ene-10-carbonyl) 3,3,9,11,11-pentamethyl-1,5-dioxaspiro[5.5]undec-9-ene-10-carboxylate |
|---|---|
| PubChem CID | 15439103 |
| Molecular Formula | C30H46O7 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.32 |
| IUPAC Name | (3,3,9,11,11-pentamethyl-1,5-dioxaspiro[5.5]undec-9-ene-10-carbonyl) 3,3,9,11,11-pentamethyl-1,5-dioxaspiro[5.5]undec-9-ene-10-carboxylate |
| SMILES | CC1=C(C(=O)OC(=O)C2=C(C)CCC3(OCC(C)(C)CO3)C2(C)C)C(C)(C)C2(CC1)OCC(C)(C)CO2 |
| InChI | InChI=1S/C30H46O7/c1-19-11-13-29(33-15-25(3,4)16-34-29)27(7,8)21(19)23(31)37-24(32)22-20(2)12-14-30(28(22,9)10)35-17-26(5,6)18-36-30/h11-18H2,1-10H3 |
| InChIKey | KBVPECTVIQTTNQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|