C22H35N3O3 — CID 154392787
N-[2,4-bis(2,2-dimethylpropanoylamino)phenyl]-4-methylpentanamide (PubChem CID 154392787) has the molecular formula C22H35N3O3 and a molecular weight of 389.54 g/mol. Its IUPAC name is N-[2,4-bis(2,2-dimethylpropanoylamino)phenyl]-4-methylpentanamide.
| Compound Name | N-[2,4-bis(2,2-dimethylpropanoylamino)phenyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 154392787 |
| Molecular Formula | C22H35N3O3 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | N-[2,4-bis(2,2-dimethylpropanoylamino)phenyl]-4-methylpentanamide |
| SMILES | CC(C)CCC(=O)Nc1ccc(NC(=O)C(C)(C)C)cc1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C22H35N3O3/c1-14(2)9-12-18(26)24-16-11-10-15(23-19(27)21(3,4)5)13-17(16)25-20(28)22(6,7)8/h10-11,13-14H,9,12H2,1-8H3,(H,23,27)(H,24,26)(H,25,28) |
| InChIKey | UACVCEPLYXURSB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |