C17H20O6S2 — CID 15440061
diethyl (4R,5R)-spiro[1,3-dioxolane-2,3'-2,4-dihydro-1,5-benzodithiepine]-4,5-dicarboxylate (PubChem CID 15440061) has the molecular formula C17H20O6S2 and a molecular weight of 384.48 g/mol. Its IUPAC name is diethyl (4R,5R)-spiro[1,3-dioxolane-2,3'-2,4-dihydro-1,5-benzodithiepine]-4,5-dicarboxylate.
| Compound Name | diethyl (4R,5R)-spiro[1,3-dioxolane-2,3'-2,4-dihydro-1,5-benzodithiepine]-4,5-dicarboxylate |
|---|---|
| PubChem CID | 15440061 |
| Molecular Formula | C17H20O6S2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | diethyl (4R,5R)-spiro[1,3-dioxolane-2,3'-2,4-dihydro-1,5-benzodithiepine]-4,5-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1OC2(CSc3ccccc3SC2)O[C@H]1C(=O)OCC |
| InChI | InChI=1S/C17H20O6S2/c1-3-20-15(18)13-14(16(19)21-4-2)23-17(22-13)9-24-11-7-5-6-8-12(11)25-10-17/h5-8,13-14H,3-4,9-10H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | ALEONKGYTMNTGX-ZIAGYGMSSA-N |
| XLogP | 2.49 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |