C15H18O4S — CID 102417676
(3aR,6S,8aR)-2,2-dimethyl-6-phenylsulfanyl-4,6,7,8a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]oxepin-8-one (PubChem CID 102417676) has the molecular formula C15H18O4S and a molecular weight of 294.37 g/mol. Its IUPAC name is (3aR,6S,8aR)-2,2-dimethyl-6-phenylsulfanyl-4,6,7,8a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]oxepin-8-one.
| Compound Name | (3aR,6S,8aR)-2,2-dimethyl-6-phenylsulfanyl-4,6,7,8a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]oxepin-8-one |
|---|---|
| PubChem CID | 102417676 |
| Molecular Formula | C15H18O4S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | (3aR,6S,8aR)-2,2-dimethyl-6-phenylsulfanyl-4,6,7,8a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]oxepin-8-one |
| SMILES | CC1(C)O[C@@H]2CO[C@@H](Sc3ccccc3)CC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C15H18O4S/c1-15(2)18-12-9-17-13(8-11(16)14(12)19-15)20-10-6-4-3-5-7-10/h3-7,12-14H,8-9H2,1-2H3/t12-,13+,14+/m1/s1 |
| InChIKey | PRGYBQIBLMXBJO-RDBSUJKOSA-N |
| XLogP | 2.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |