About 4,4-diphenylbut-2-enal
4,4-diphenylbut-2-enal (PubChem CID 154401916) has the molecular formula C16H14O
and a molecular weight of 222.29 g/mol. Its IUPAC name is 4,4-diphenylbut-2-enal.
Molecular Properties
| Compound Name | 4,4-diphenylbut-2-enal |
| PubChem CID | 154401916 |
| Molecular Formula | C16H14O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 4,4-diphenylbut-2-enal |
| SMILES | O=CC=CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H14O/c17-13-7-12-16(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-13,16H |
| InChIKey | ACYRBRFEQNIRFF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4,4-diphenylbut-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-diphenylbut-2-enal?
The IUPAC name of 4,4-diphenylbut-2-enal (CID 154401916) is 4,4-diphenylbut-2-enal.
What is the SMILES notation for 4,4-diphenylbut-2-enal?
The canonical SMILES for 4,4-diphenylbut-2-enal is O=CC=CC(c1ccccc1)c1ccccc1.
What is the InChIKey of 4,4-diphenylbut-2-enal?
The InChIKey is ACYRBRFEQNIRFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O/c17-13-7-12-16(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-13,16H.
What are the key properties of 4,4-diphenylbut-2-enal?
4,4-diphenylbut-2-enal has a molecular weight of 222.29 g/mol, XLogP of 3.57, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-diphenylbut-2-enal is sourced from PubChem (CID 154401916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).