C31H54O6Si — CID 154404415
propan-2-yl (Z)-7-[(1R,2R,3R)-2-[(E)-3-acetyloxyoct-1-enyl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopentyl]hept-5-enoate (PubChem CID 154404415) has the molecular formula C31H54O6Si and a molecular weight of 550.85 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,2R,3R)-2-[(E)-3-acetyloxyoct-1-enyl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,2R,3R)-2-[(E)-3-acetyloxyoct-1-enyl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 154404415 |
| Molecular Formula | C31H54O6Si |
| Molecular Weight | 550.85 g/mol |
| Exact Mass | 550.37 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,2R,3R)-2-[(E)-3-acetyloxyoct-1-enyl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(/C=C/[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@@H]1C/C=C\CCCC(=O)OC(C)C)OC(C)=O |
| InChI | InChI=1S/C31H54O6Si/c1-10-11-14-17-25(36-24(4)32)20-21-27-26(18-15-12-13-16-19-30(34)35-23(2)3)28(33)22-29(27)37-38(8,9)31(5,6)7/h12,15,20-21,23,25-27,29H,10-11,13-14,16-19,22H2,1-9H3/b15-12-,21-20+/t25?,26-,27-,29-/m1/s1 |
| InChIKey | VIJRAULELJRCKT-KJBGIMLOSA-N |
| XLogP | 7.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.85 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|