C12H20O2 — CID 15441076
(3R,5Z,9R,10E)-dodeca-1,5,10-triene-3,9-diol (PubChem CID 15441076) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (3R,5Z,9R,10E)-dodeca-1,5,10-triene-3,9-diol.
| Compound Name | (3R,5Z,9R,10E)-dodeca-1,5,10-triene-3,9-diol |
|---|---|
| PubChem CID | 15441076 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (3R,5Z,9R,10E)-dodeca-1,5,10-triene-3,9-diol |
| SMILES | C=C[C@H](O)C/C=C\CC[C@@H](O)/C=C/C |
| InChI | InChI=1S/C12H20O2/c1-3-8-12(14)10-7-5-6-9-11(13)4-2/h3-6,8,11-14H,2,7,9-10H2,1H3/b6-5-,8-3+/t11-,12-/m0/s1 |
| InChIKey | RNUCIRODTXLBNP-GITPXMONSA-N |
| XLogP | 2.20 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|