C13H14NO2- — CID 154411377
5-[(4-propylphenyl)methyl]-2H-1,3-oxazol-2-id-4-one (PubChem CID 154411377) has the molecular formula C13H14NO2- and a molecular weight of 216.26 g/mol. Its IUPAC name is 5-[(4-propylphenyl)methyl]-2H-1,3-oxazol-2-id-4-one.
| Compound Name | 5-[(4-propylphenyl)methyl]-2H-1,3-oxazol-2-id-4-one |
|---|---|
| PubChem CID | 154411377 |
| Molecular Formula | C13H14NO2- |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 5-[(4-propylphenyl)methyl]-2H-1,3-oxazol-2-id-4-one |
| SMILES | CCCc1ccc(CC2O[C-]=NC2=O)cc1 |
| InChI | InChI=1S/C13H14NO2/c1-2-3-10-4-6-11(7-5-10)8-12-13(15)14-9-16-12/h4-7,12H,2-3,8H2,1H3/q-1 |
| InChIKey | WFOVJTNUCNMBLN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|