C56H67NO2P2 — CID 15441201
N,N-bis(4-methoxyphenyl)-4-(2,4,6-tritert-butylphenyl)phosphanylidenephosphanyl-3,5-bis(2,4,6-trimethylphenyl)aniline (PubChem CID 15441201) has the molecular formula C56H67NO2P2 and a molecular weight of 848.11 g/mol. Its IUPAC name is N,N-bis(4-methoxyphenyl)-4-(2,4,6-tritert-butylphenyl)phosphanylidenephosphanyl-3,5-bis(2,4,6-trimethylphenyl)aniline.
| Compound Name | N,N-bis(4-methoxyphenyl)-4-(2,4,6-tritert-butylphenyl)phosphanylidenephosphanyl-3,5-bis(2,4,6-trimethylphenyl)aniline |
|---|---|
| PubChem CID | 15441201 |
| Molecular Formula | C56H67NO2P2 |
| Molecular Weight | 848.11 g/mol |
| Exact Mass | 847.46 |
| IUPAC Name | N,N-bis(4-methoxyphenyl)-4-(2,4,6-tritert-butylphenyl)phosphanylidenephosphanyl-3,5-bis(2,4,6-trimethylphenyl)aniline |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2cc(-c3c(C)cc(C)cc3C)c(/P=P/c3c(C(C)(C)C)cc(C(C)(C)C)cc3C(C)(C)C)c(-c3c(C)cc(C)cc3C)c2)cc1 |
| InChI | InChI=1S/C56H67NO2P2/c1-34-26-36(3)50(37(4)27-34)46-32-43(57(41-18-22-44(58-16)23-19-41)42-20-24-45(59-17)25-21-42)33-47(51-38(5)28-35(2)29-39(51)6)52(46)60-61-53-48(55(10,11)12)30-40(54(7,8)9)31-49(53)56(13,14)15/h18-33H,1-17H3 |
| InChIKey | DVSVAKBUIVYZFV-UHFFFAOYSA-N |
| XLogP | 16.01 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.11 |
| LogP ≤ 5 | 16.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|