C42H36N2O4 — CID 20665545
9-N,9-N,10-N,10-N-tetrakis(4-methoxyphenyl)anthracene-9,10-diamine (PubChem CID 20665545) has the molecular formula C42H36N2O4 and a molecular weight of 632.76 g/mol. Its IUPAC name is 9-N,9-N,10-N,10-N-tetrakis(4-methoxyphenyl)anthracene-9,10-diamine.
| Compound Name | 9-N,9-N,10-N,10-N-tetrakis(4-methoxyphenyl)anthracene-9,10-diamine |
|---|---|
| PubChem CID | 20665545 |
| Molecular Formula | C42H36N2O4 |
| Molecular Weight | 632.76 g/mol |
| Exact Mass | 632.27 |
| IUPAC Name | 9-N,9-N,10-N,10-N-tetrakis(4-methoxyphenyl)anthracene-9,10-diamine |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2c3ccccc3c(N(c3ccc(OC)cc3)c3ccc(OC)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C42H36N2O4/c1-45-33-21-13-29(14-22-33)43(30-15-23-34(46-2)24-16-30)41-37-9-5-7-11-39(37)42(40-12-8-6-10-38(40)41)44(31-17-25-35(47-3)26-18-31)32-19-27-36(48-4)28-20-32/h5-28H,1-4H3 |
| InChIKey | RBKYPMZXWQOGGR-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.76 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|