C16H18N10O5S3 — CID 154412899
(6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(2-methanehydrazonoylsulfanylethoxyimino)acetyl]amino]-3-(azidomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 154412899) has the molecular formula C16H18N10O5S3 and a molecular weight of 526.59 g/mol. Its IUPAC name is (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(2-methanehydrazonoylsulfanylethoxyimino)acetyl]amino]-3-(azidomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(2-methanehydrazonoylsulfanylethoxyimino)acetyl]amino]-3-(azidomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154412899 |
| Molecular Formula | C16H18N10O5S3 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.06 |
| IUPAC Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(2-methanehydrazonoylsulfanylethoxyimino)acetyl]amino]-3-(azidomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | [N-]=[N+]=NCC1=C(C(=O)O)N2C(=O)C(NC(=O)C(=NOCCSC=NN)c3csc(N)n3)[C@H]2SC1 |
| InChI | InChI=1S/C16H18N10O5S3/c17-16-22-8(5-34-16)9(24-31-1-2-32-6-20-18)12(27)23-10-13(28)26-11(15(29)30)7(3-21-25-19)4-33-14(10)26/h5-6,10,14H,1-4,18H2,(H2,17,22)(H,23,27)(H,29,30)/t10?,14-/m1/s1 |
| InChIKey | MXHQQHWYLPVIGO-LNUXAPHWSA-N |
| XLogP | 0.13 |
| TPSA | 234.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|