C11H15N3O3S — CID 154413238
(5S)-3-[2-(dimethylamino)-2-iminoethyl]sulfanyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 154413238) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is (5S)-3-[2-(dimethylamino)-2-iminoethyl]sulfanyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5S)-3-[2-(dimethylamino)-2-iminoethyl]sulfanyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154413238 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | (5S)-3-[2-(dimethylamino)-2-iminoethyl]sulfanyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | [H]/N=C(/CSC1=C(C(=O)O)N2C(=O)C[C@H]2C1)N(C)C |
| InChI | InChI=1S/C11H15N3O3S/c1-13(2)8(12)5-18-7-3-6-4-9(15)14(6)10(7)11(16)17/h6,12H,3-5H2,1-2H3,(H,16,17)/b12-8-/t6-/m1/s1 |
| InChIKey | SCSORVFRQVPSKS-UMZRBQTHSA-N |
| XLogP | 0.56 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|