C8H15NO6 — CID 141132897
3-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid;trihydrate (PubChem CID 141132897) has the molecular formula C8H15NO6 and a molecular weight of 221.21 g/mol. Its IUPAC name is 3-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid;trihydrate.
| Compound Name | 3-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid;trihydrate |
|---|---|
| PubChem CID | 141132897 |
| Molecular Formula | C8H15NO6 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 3-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid;trihydrate |
| SMILES | CC1=C(C(=O)O)N2C(=O)CC2C1.O.O.O |
| InChI | InChI=1S/C8H9NO3.3H2O/c1-4-2-5-3-6(10)9(5)7(4)8(11)12;;;/h5H,2-3H2,1H3,(H,11,12);3*1H2 |
| InChIKey | NTJRNROTCBFOCT-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |