C11H13NO5 — CID 54222235
8-oxo-3-(oxolan-2-yl)-4-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54222235) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is 8-oxo-3-(oxolan-2-yl)-4-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | 8-oxo-3-(oxolan-2-yl)-4-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54222235 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 8-oxo-3-(oxolan-2-yl)-4-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | O=C(O)C1=C(C2CCCO2)OCC2CC(=O)N12 |
| InChI | InChI=1S/C11H13NO5/c13-8-4-6-5-17-10(7-2-1-3-16-7)9(11(14)15)12(6)8/h6-7H,1-5H2,(H,14,15) |
| InChIKey | QDKIKPJUAQDVJP-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |