C20H25NO5S2 — CID 154413890
[1-(4-methylphenyl)sulfonylazepan-4-yl] 2-methylbenzenesulfonate (PubChem CID 154413890) has the molecular formula C20H25NO5S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is [1-(4-methylphenyl)sulfonylazepan-4-yl] 2-methylbenzenesulfonate.
| Compound Name | [1-(4-methylphenyl)sulfonylazepan-4-yl] 2-methylbenzenesulfonate |
|---|---|
| PubChem CID | 154413890 |
| Molecular Formula | C20H25NO5S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | [1-(4-methylphenyl)sulfonylazepan-4-yl] 2-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(OS(=O)(=O)c3ccccc3C)CC2)cc1 |
| InChI | InChI=1S/C20H25NO5S2/c1-16-9-11-19(12-10-16)27(22,23)21-14-5-7-18(13-15-21)26-28(24,25)20-8-4-3-6-17(20)2/h3-4,6,8-12,18H,5,7,13-15H2,1-2H3 |
| InChIKey | BFJVEIXWBLWMFZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|