C27H33N3O12S — CID 154418187
(6R)-3-(acetyloxymethyl)-7-[[5-benzamido-6-(2-methoxyethoxymethoxy)-6-oxohexanoyl]amino]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 154418187) has the molecular formula C27H33N3O12S and a molecular weight of 623.64 g/mol. Its IUPAC name is (6R)-3-(acetyloxymethyl)-7-[[5-benzamido-6-(2-methoxyethoxymethoxy)-6-oxohexanoyl]amino]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-3-(acetyloxymethyl)-7-[[5-benzamido-6-(2-methoxyethoxymethoxy)-6-oxohexanoyl]amino]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154418187 |
| Molecular Formula | C27H33N3O12S |
| Molecular Weight | 623.64 g/mol |
| Exact Mass | 623.18 |
| IUPAC Name | (6R)-3-(acetyloxymethyl)-7-[[5-benzamido-6-(2-methoxyethoxymethoxy)-6-oxohexanoyl]amino]-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | COCCOCOC(=O)C(CCCC(=O)NC1C(=O)N2C(C(=O)O)=C(COC(C)=O)CS(=O)[C@H]12)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H33N3O12S/c1-16(31)41-13-18-14-43(38)25-21(24(34)30(25)22(18)26(35)36)29-20(32)10-6-9-19(27(37)42-15-40-12-11-39-2)28-23(33)17-7-4-3-5-8-17/h3-5,7-8,19,21,25H,6,9-15H2,1-2H3,(H,28,33)(H,29,32)(H,35,36)/t19?,21?,25-,43?/m1/s1 |
| InChIKey | CCXNVQNPEKNINE-TXBFGNFQSA-N |
| XLogP | -0.56 |
| TPSA | 203.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.64 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|