C7H11ClN2 — CID 154425047
4-chloro-1-N'-methylcyclohexa-2,4-diene-1,1-diamine (PubChem CID 154425047) has the molecular formula C7H11ClN2 and a molecular weight of 158.63 g/mol. Its IUPAC name is 4-chloro-1-N'-methylcyclohexa-2,4-diene-1,1-diamine.
| Compound Name | 4-chloro-1-N'-methylcyclohexa-2,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 154425047 |
| Molecular Formula | C7H11ClN2 |
| Molecular Weight | 158.63 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 4-chloro-1-N'-methylcyclohexa-2,4-diene-1,1-diamine |
| SMILES | CNC1(N)C=CC(Cl)=CC1 |
| InChI | InChI=1S/C7H11ClN2/c1-10-7(9)4-2-6(8)3-5-7/h2-4,10H,5,9H2,1H3 |
| InChIKey | XBFDLBGCDRLTPT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.63 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|