C8H13FN2 — CID 154507667
5-fluoro-1-N,1-N'-dimethylcyclohexa-2,4-diene-1,1-diamine (PubChem CID 154507667) has the molecular formula C8H13FN2 and a molecular weight of 156.20 g/mol. Its IUPAC name is 5-fluoro-1-N,1-N'-dimethylcyclohexa-2,4-diene-1,1-diamine.
| Compound Name | 5-fluoro-1-N,1-N'-dimethylcyclohexa-2,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 154507667 |
| Molecular Formula | C8H13FN2 |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | 5-fluoro-1-N,1-N'-dimethylcyclohexa-2,4-diene-1,1-diamine |
| SMILES | CNC1(NC)C=CC=C(F)C1 |
| InChI | InChI=1S/C8H13FN2/c1-10-8(11-2)5-3-4-7(9)6-8/h3-5,10-11H,6H2,1-2H3 |
| InChIKey | ZEPBYOVXJARRQW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|