C10H18N2 — CID 150686114
1-N,1-N'-diethylcyclohexa-2,4-diene-1,1-diamine (PubChem CID 150686114) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-N,1-N'-diethylcyclohexa-2,4-diene-1,1-diamine.
| Compound Name | 1-N,1-N'-diethylcyclohexa-2,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 150686114 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-N,1-N'-diethylcyclohexa-2,4-diene-1,1-diamine |
| SMILES | CCNC1(NCC)C=CC=CC1 |
| InChI | InChI=1S/C10H18N2/c1-3-11-10(12-4-2)8-6-5-7-9-10/h5-8,11-12H,3-4,9H2,1-2H3 |
| InChIKey | JIWXXTUKFKLSRD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|