About 2-methyl-2,3,3a,7a-tetrahydro-1H-benzimidazole
2-methyl-2,3,3a,7a-tetrahydro-1H-benzimidazole (PubChem CID 22258251) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 2-methyl-2,3,3a,7a-tetrahydro-1H-benzimidazole.
Analyze 2-methyl-2,3,3a,7a-tetrahydro-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,3,3a,7a-tetrahydro-1H-benzimidazole?
The IUPAC name of 2-methyl-2,3,3a,7a-tetrahydro-1H-benzimidazole (CID 22258251) is 2-methyl-2,3,3a,7a-tetrahydro-1H-benzimidazole.
What is the SMILES notation for 2-methyl-2,3,3a,7a-tetrahydro-1H-benzimidazole?
The canonical SMILES for 2-methyl-2,3,3a,7a-tetrahydro-1H-benzimidazole is CC1NC2C=CC=CC2N1.
What is the InChIKey of 2-methyl-2,3,3a,7a-tetrahydro-1H-benzimidazole?
The InChIKey is WUPWFDLHHOZCDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-6-9-7-4-2-3-5-8(7)10-6/h2-10H,1H3.
What are the key properties of 2-methyl-2,3,3a,7a-tetrahydro-1H-benzimidazole?
2-methyl-2,3,3a,7a-tetrahydro-1H-benzimidazole has a molecular weight of 136.20 g/mol, XLogP of 0.39, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,3,3a,7a-tetrahydro-1H-benzimidazole is sourced from PubChem (CID 22258251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).