C21H24N4O6S — CID 154425392
tert-butyl (6R)-3-(acetamidocarbamoyl)-7-benzamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 154425392) has the molecular formula C21H24N4O6S and a molecular weight of 460.51 g/mol. Its IUPAC name is tert-butyl (6R)-3-(acetamidocarbamoyl)-7-benzamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | tert-butyl (6R)-3-(acetamidocarbamoyl)-7-benzamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 154425392 |
| Molecular Formula | C21H24N4O6S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | tert-butyl (6R)-3-(acetamidocarbamoyl)-7-benzamido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)NNC(=O)C1=C(C(=O)OC(C)(C)C)N2C(=O)C(NC(=O)c3ccccc3)[C@H]2SC1 |
| InChI | InChI=1S/C21H24N4O6S/c1-11(26)23-24-17(28)13-10-32-19-14(22-16(27)12-8-6-5-7-9-12)18(29)25(19)15(13)20(30)31-21(2,3)4/h5-9,14,19H,10H2,1-4H3,(H,22,27)(H,23,26)(H,24,28)/t14?,19-/m1/s1 |
| InChIKey | RRDICLORIHOBDN-JANGERMGSA-N |
| XLogP | 0.46 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|