C19H18N4O8S — CID 54143415
(6S)-3-(acetamidocarbamoyl)-7-[(2-carboxy-2-phenylacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54143415) has the molecular formula C19H18N4O8S and a molecular weight of 462.44 g/mol. Its IUPAC name is (6S)-3-(acetamidocarbamoyl)-7-[(2-carboxy-2-phenylacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-3-(acetamidocarbamoyl)-7-[(2-carboxy-2-phenylacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54143415 |
| Molecular Formula | C19H18N4O8S |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | (6S)-3-(acetamidocarbamoyl)-7-[(2-carboxy-2-phenylacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC(=O)NNC(=O)C1=C(C(=O)O)N2C(=O)C(NC(=O)C(C(=O)O)c3ccccc3)[C@@H]2SC1 |
| InChI | InChI=1S/C19H18N4O8S/c1-8(24)21-22-14(25)10-7-32-17-12(16(27)23(17)13(10)19(30)31)20-15(26)11(18(28)29)9-5-3-2-4-6-9/h2-6,11-12,17H,7H2,1H3,(H,20,26)(H,21,24)(H,22,25)(H,28,29)(H,30,31)/t11?,12?,17-/m0/s1 |
| InChIKey | OCRAYKBFLVSMGP-MFGLSYLJSA-N |
| XLogP | -1.24 |
| TPSA | 182.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|