C17H14N2O8S — CID 88843485
(6S)-7-[(2-formyloxy-2-phenylacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2,3-dicarboxylic acid (PubChem CID 88843485) has the molecular formula C17H14N2O8S and a molecular weight of 406.37 g/mol. Its IUPAC name is (6S)-7-[(2-formyloxy-2-phenylacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2,3-dicarboxylic acid.
| Compound Name | (6S)-7-[(2-formyloxy-2-phenylacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 88843485 |
| Molecular Formula | C17H14N2O8S |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | (6S)-7-[(2-formyloxy-2-phenylacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2,3-dicarboxylic acid |
| SMILES | O=COC(C(=O)NC1C(=O)N2C(C(=O)O)=C(C(=O)O)CS[C@@H]12)c1ccccc1 |
| InChI | InChI=1S/C17H14N2O8S/c20-7-27-12(8-4-2-1-3-5-8)13(21)18-10-14(22)19-11(17(25)26)9(16(23)24)6-28-15(10)19/h1-5,7,10,12,15H,6H2,(H,18,21)(H,23,24)(H,25,26)/t10?,12?,15-/m0/s1 |
| InChIKey | YASAUDRBDSOMDO-QHAMSDLMSA-N |
| XLogP | -0.28 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|