C17H15Cl2NO3 — CID 15442605
3-(2,6-dichlorophenyl)-6,7a-diethyl-3aH-1,2-benzoxazole-4,7-dione (PubChem CID 15442605) has the molecular formula C17H15Cl2NO3 and a molecular weight of 352.22 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-6,7a-diethyl-3aH-1,2-benzoxazole-4,7-dione.
| Compound Name | 3-(2,6-dichlorophenyl)-6,7a-diethyl-3aH-1,2-benzoxazole-4,7-dione |
|---|---|
| PubChem CID | 15442605 |
| Molecular Formula | C17H15Cl2NO3 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-6,7a-diethyl-3aH-1,2-benzoxazole-4,7-dione |
| SMILES | CCC1=CC(=O)C2C(c3c(Cl)cccc3Cl)=NOC2(CC)C1=O |
| InChI | InChI=1S/C17H15Cl2NO3/c1-3-9-8-12(21)14-15(13-10(18)6-5-7-11(13)19)20-23-17(14,4-2)16(9)22/h5-8,14H,3-4H2,1-2H3 |
| InChIKey | INEUXCWLOQCYIH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |