C18H11Cl2NO3 — CID 13228186
3-(2,6-dichlorophenyl)-9a-methyl-3aH-benzo[f][1,2]benzoxazole-4,9-dione (PubChem CID 13228186) has the molecular formula C18H11Cl2NO3 and a molecular weight of 360.20 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-9a-methyl-3aH-benzo[f][1,2]benzoxazole-4,9-dione.
| Compound Name | 3-(2,6-dichlorophenyl)-9a-methyl-3aH-benzo[f][1,2]benzoxazole-4,9-dione |
|---|---|
| PubChem CID | 13228186 |
| Molecular Formula | C18H11Cl2NO3 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-9a-methyl-3aH-benzo[f][1,2]benzoxazole-4,9-dione |
| SMILES | CC12ON=C(c3c(Cl)cccc3Cl)C1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H11Cl2NO3/c1-18-14(16(22)9-5-2-3-6-10(9)17(18)23)15(21-24-18)13-11(19)7-4-8-12(13)20/h2-8,14H,1H3 |
| InChIKey | UUMFBCAWMRJLEO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|