C13H11NO3 — CID 90831619
3,9a-dimethyl-3aH-benzo[f][1,2]benzoxazole-4,9-dione (PubChem CID 90831619) has the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. Its IUPAC name is 3,9a-dimethyl-3aH-benzo[f][1,2]benzoxazole-4,9-dione.
| Compound Name | 3,9a-dimethyl-3aH-benzo[f][1,2]benzoxazole-4,9-dione |
|---|---|
| PubChem CID | 90831619 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 3,9a-dimethyl-3aH-benzo[f][1,2]benzoxazole-4,9-dione |
| SMILES | CC1=NOC2(C)C(=O)c3ccccc3C(=O)C12 |
| InChI | InChI=1S/C13H11NO3/c1-7-10-11(15)8-5-3-4-6-9(8)12(16)13(10,2)17-14-7/h3-6,10H,1-2H3 |
| InChIKey | BIYHTMXJGKAZLT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|