C14H11NO5 — CID 135000593
ethyl 4,9-dioxo-3a,9a-dihydrobenzo[f][1,2]benzoxazole-3-carboxylate (PubChem CID 135000593) has the molecular formula C14H11NO5 and a molecular weight of 273.24 g/mol. Its IUPAC name is ethyl 4,9-dioxo-3a,9a-dihydrobenzo[f][1,2]benzoxazole-3-carboxylate.
| Compound Name | ethyl 4,9-dioxo-3a,9a-dihydrobenzo[f][1,2]benzoxazole-3-carboxylate |
|---|---|
| PubChem CID | 135000593 |
| Molecular Formula | C14H11NO5 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | ethyl 4,9-dioxo-3a,9a-dihydrobenzo[f][1,2]benzoxazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NOC2C(=O)c3ccccc3C(=O)C12 |
| InChI | InChI=1S/C14H11NO5/c1-2-19-14(18)10-9-11(16)7-5-3-4-6-8(7)12(17)13(9)20-15-10/h3-6,9,13H,2H2,1H3 |
| InChIKey | WGFDTSZDFHJAFP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|