C14H12O4 — CID 125130392
(2S,3aR,9aR)-2-acetyl-2,3,3a,9a-tetrahydrobenzo[f][1]benzofuran-4,9-dione (PubChem CID 125130392) has the molecular formula C14H12O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is (2S,3aR,9aR)-2-acetyl-2,3,3a,9a-tetrahydrobenzo[f][1]benzofuran-4,9-dione.
| Compound Name | (2S,3aR,9aR)-2-acetyl-2,3,3a,9a-tetrahydrobenzo[f][1]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 125130392 |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (2S,3aR,9aR)-2-acetyl-2,3,3a,9a-tetrahydrobenzo[f][1]benzofuran-4,9-dione |
| SMILES | CC(=O)[C@@H]1C[C@H]2C(=O)c3ccccc3C(=O)[C@@H]2O1 |
| InChI | InChI=1S/C14H12O4/c1-7(15)11-6-10-12(16)8-4-2-3-5-9(8)13(17)14(10)18-11/h2-5,10-11,14H,6H2,1H3/t10-,11-,14+/m0/s1 |
| InChIKey | RYPOUKODPUOITK-COPLHBTASA-N |
| XLogP | 1.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|