C15H14O3 — CID 163018299
(4aS,10aS)-2,2-dimethyl-4a,10a-dihydrobenzo[g]chromene-5,10-dione (PubChem CID 163018299) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is (4aS,10aS)-2,2-dimethyl-4a,10a-dihydrobenzo[g]chromene-5,10-dione.
| Compound Name | (4aS,10aS)-2,2-dimethyl-4a,10a-dihydrobenzo[g]chromene-5,10-dione |
|---|---|
| PubChem CID | 163018299 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | (4aS,10aS)-2,2-dimethyl-4a,10a-dihydrobenzo[g]chromene-5,10-dione |
| SMILES | CC1(C)C=C[C@@H]2C(=O)c3ccccc3C(=O)[C@H]2O1 |
| InChI | InChI=1S/C15H14O3/c1-15(2)8-7-11-12(16)9-5-3-4-6-10(9)13(17)14(11)18-15/h3-8,11,14H,1-2H3/t11-,14+/m1/s1 |
| InChIKey | KSTZCKLHDQOIJZ-RISCZKNCSA-N |
| XLogP | 2.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|